About butan-2-yloxyalumane
butan-2-yloxyalumane (PubChem CID 173404497) has the molecular formula C4H11AlO
and a molecular weight of 102.11 g/mol. Its IUPAC name is butan-2-yloxyalumane.
Molecular Properties
| Compound Name | butan-2-yloxyalumane |
| PubChem CID | 173404497 |
| Molecular Formula | C4H11AlO |
| Molecular Weight | 102.11 g/mol |
| Exact Mass | 102.06 |
| IUPAC Name | butan-2-yloxyalumane |
| SMILES | CCC(C)O[AlH2] |
| InChI | InChI=1S/C4H9O.Al.2H/c1-3-4(2)5;;;/h4H,3H2,1-2H3;;;/q-1;+1;; |
| InChIKey | NYVGRADTOIQFJS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-2-yloxyalumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yloxyalumane?
The IUPAC name of butan-2-yloxyalumane (CID 173404497) is butan-2-yloxyalumane.
What is the SMILES notation for butan-2-yloxyalumane?
The canonical SMILES for butan-2-yloxyalumane is CCC(C)O[AlH2].
What is the InChIKey of butan-2-yloxyalumane?
The InChIKey is NYVGRADTOIQFJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.Al.2H/c1-3-4(2)5;;;/h4H,3H2,1-2H3;;;/q-1;+1;;.
What are the key properties of butan-2-yloxyalumane?
butan-2-yloxyalumane has a molecular weight of 102.11 g/mol, XLogP of 0.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yloxyalumane is sourced from PubChem (CID 173404497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).