About dibutan-2-yl sulfite
dibutan-2-yl sulfite (PubChem CID 545722) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is dibutan-2-yl sulfite.
Molecular Properties
| Compound Name | dibutan-2-yl sulfite |
| PubChem CID | 545722 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | dibutan-2-yl sulfite |
| SMILES | CCC(C)OS(=O)OC(C)CC |
| InChI | InChI=1S/C8H18O3S/c1-5-7(3)10-12(9)11-8(4)6-2/h7-8H,5-6H2,1-4H3 |
| InChIKey | RZIOGLWQPURKKN-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dibutan-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutan-2-yl sulfite?
The IUPAC name of dibutan-2-yl sulfite (CID 545722) is dibutan-2-yl sulfite.
What is the SMILES notation for dibutan-2-yl sulfite?
The canonical SMILES for dibutan-2-yl sulfite is CCC(C)OS(=O)OC(C)CC.
What is the InChIKey of dibutan-2-yl sulfite?
The InChIKey is RZIOGLWQPURKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3S/c1-5-7(3)10-12(9)11-8(4)6-2/h7-8H,5-6H2,1-4H3.
What are the key properties of dibutan-2-yl sulfite?
dibutan-2-yl sulfite has a molecular weight of 194.30 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibutan-2-yl sulfite is sourced from PubChem (CID 545722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).