About propan-2-yl propyl sulfite
propan-2-yl propyl sulfite (PubChem CID 134895903) has the molecular formula C6H14O3S
and a molecular weight of 166.24 g/mol. Its IUPAC name is propan-2-yl propyl sulfite.
Molecular Properties
| Compound Name | propan-2-yl propyl sulfite |
| PubChem CID | 134895903 |
| Molecular Formula | C6H14O3S |
| Molecular Weight | 166.24 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | propan-2-yl propyl sulfite |
| SMILES | CCCOS(=O)OC(C)C |
| InChI | InChI=1S/C6H14O3S/c1-4-5-8-10(7)9-6(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | YONDATGAIHKGJS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl propyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl propyl sulfite?
The IUPAC name of propan-2-yl propyl sulfite (CID 134895903) is propan-2-yl propyl sulfite.
What is the SMILES notation for propan-2-yl propyl sulfite?
The canonical SMILES for propan-2-yl propyl sulfite is CCCOS(=O)OC(C)C.
What is the InChIKey of propan-2-yl propyl sulfite?
The InChIKey is YONDATGAIHKGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O3S/c1-4-5-8-10(7)9-6(2)3/h6H,4-5H2,1-3H3.
What are the key properties of propan-2-yl propyl sulfite?
propan-2-yl propyl sulfite has a molecular weight of 166.24 g/mol, XLogP of 1.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl propyl sulfite is sourced from PubChem (CID 134895903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).