About bis(2-methylbutyl) sulfite
bis(2-methylbutyl) sulfite (PubChem CID 87261553) has the molecular formula C10H22O3S
and a molecular weight of 222.35 g/mol. Its IUPAC name is bis(2-methylbutyl) sulfite.
Molecular Properties
| Compound Name | bis(2-methylbutyl) sulfite |
| PubChem CID | 87261553 |
| Molecular Formula | C10H22O3S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | bis(2-methylbutyl) sulfite |
| SMILES | CCC(C)COS(=O)OCC(C)CC |
| InChI | InChI=1S/C10H22O3S/c1-5-9(3)7-12-14(11)13-8-10(4)6-2/h9-10H,5-8H2,1-4H3 |
| InChIKey | RYKNBSVUMVKNNX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(2-methylbutyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylbutyl) sulfite?
The IUPAC name of bis(2-methylbutyl) sulfite (CID 87261553) is bis(2-methylbutyl) sulfite.
What is the SMILES notation for bis(2-methylbutyl) sulfite?
The canonical SMILES for bis(2-methylbutyl) sulfite is CCC(C)COS(=O)OCC(C)CC.
What is the InChIKey of bis(2-methylbutyl) sulfite?
The InChIKey is RYKNBSVUMVKNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3S/c1-5-9(3)7-12-14(11)13-8-10(4)6-2/h9-10H,5-8H2,1-4H3.
What are the key properties of bis(2-methylbutyl) sulfite?
bis(2-methylbutyl) sulfite has a molecular weight of 222.35 g/mol, XLogP of 2.69, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylbutyl) sulfite is sourced from PubChem (CID 87261553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).