About (4-methoxy-2-methylbutyl) undecyl sulfite
(4-methoxy-2-methylbutyl) undecyl sulfite (PubChem CID 6421838) has the molecular formula C17H36O4S
and a molecular weight of 336.54 g/mol. Its IUPAC name is (4-methoxy-2-methylbutyl) undecyl sulfite.
Molecular Properties
| Compound Name | (4-methoxy-2-methylbutyl) undecyl sulfite |
| PubChem CID | 6421838 |
| Molecular Formula | C17H36O4S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (4-methoxy-2-methylbutyl) undecyl sulfite |
| SMILES | CCCCCCCCCCCOS(=O)OCC(C)CCOC |
| InChI | InChI=1S/C17H36O4S/c1-4-5-6-7-8-9-10-11-12-14-20-22(18)21-16-17(2)13-15-19-3/h17H,4-16H2,1-3H3 |
| InChIKey | DCEDVLBQHUXOLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-2-methylbutyl) undecyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2-methylbutyl) undecyl sulfite?
The IUPAC name of (4-methoxy-2-methylbutyl) undecyl sulfite (CID 6421838) is (4-methoxy-2-methylbutyl) undecyl sulfite.
What is the SMILES notation for (4-methoxy-2-methylbutyl) undecyl sulfite?
The canonical SMILES for (4-methoxy-2-methylbutyl) undecyl sulfite is CCCCCCCCCCCOS(=O)OCC(C)CCOC.
What is the InChIKey of (4-methoxy-2-methylbutyl) undecyl sulfite?
The InChIKey is DCEDVLBQHUXOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O4S/c1-4-5-6-7-8-9-10-11-12-14-20-22(18)21-16-17(2)13-15-19-3/h17H,4-16H2,1-3H3.
What are the key properties of (4-methoxy-2-methylbutyl) undecyl sulfite?
(4-methoxy-2-methylbutyl) undecyl sulfite has a molecular weight of 336.54 g/mol, XLogP of 4.80, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2-methylbutyl) undecyl sulfite is sourced from PubChem (CID 6421838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).