About (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite
(4-methoxy-2-methylbutyl) 4-methylpentyl sulfite (PubChem CID 6421003) has the molecular formula C12H26O4S
and a molecular weight of 266.40 g/mol. Its IUPAC name is (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite.
Molecular Properties
| Compound Name | (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite |
| PubChem CID | 6421003 |
| Molecular Formula | C12H26O4S |
| Molecular Weight | 266.40 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite |
| SMILES | COCCC(C)COS(=O)OCCCC(C)C |
| InChI | InChI=1S/C12H26O4S/c1-11(2)6-5-8-15-17(13)16-10-12(3)7-9-14-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | CCPSPHSEYNPAQD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite?
The IUPAC name of (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite (CID 6421003) is (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite.
What is the SMILES notation for (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite?
The canonical SMILES for (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite is COCCC(C)COS(=O)OCCCC(C)C.
What is the InChIKey of (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite?
The InChIKey is CCPSPHSEYNPAQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O4S/c1-11(2)6-5-8-15-17(13)16-10-12(3)7-9-14-4/h11-12H,5-10H2,1-4H3.
What are the key properties of (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite?
(4-methoxy-2-methylbutyl) 4-methylpentyl sulfite has a molecular weight of 266.40 g/mol, XLogP of 2.71, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-2-methylbutyl) 4-methylpentyl sulfite is sourced from PubChem (CID 6421003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).