About 10-methylundecyl hydrogen sulfite
10-methylundecyl hydrogen sulfite (PubChem CID 175162504) has the molecular formula C12H26O3S
and a molecular weight of 250.40 g/mol. Its IUPAC name is 10-methylundecyl hydrogen sulfite.
Molecular Properties
| Compound Name | 10-methylundecyl hydrogen sulfite |
| PubChem CID | 175162504 |
| Molecular Formula | C12H26O3S |
| Molecular Weight | 250.40 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 10-methylundecyl hydrogen sulfite |
| SMILES | CC(C)CCCCCCCCCOS(=O)O |
| InChI | InChI=1S/C12H26O3S/c1-12(2)10-8-6-4-3-5-7-9-11-15-16(13)14/h12H,3-11H2,1-2H3,(H,13,14) |
| InChIKey | ZUZFEVNKUVBSJH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 10-methylundecyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methylundecyl hydrogen sulfite?
The IUPAC name of 10-methylundecyl hydrogen sulfite (CID 175162504) is 10-methylundecyl hydrogen sulfite.
What is the SMILES notation for 10-methylundecyl hydrogen sulfite?
The canonical SMILES for 10-methylundecyl hydrogen sulfite is CC(C)CCCCCCCCCOS(=O)O.
What is the InChIKey of 10-methylundecyl hydrogen sulfite?
The InChIKey is ZUZFEVNKUVBSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3S/c1-12(2)10-8-6-4-3-5-7-9-11-15-16(13)14/h12H,3-11H2,1-2H3,(H,13,14).
What are the key properties of 10-methylundecyl hydrogen sulfite?
10-methylundecyl hydrogen sulfite has a molecular weight of 250.40 g/mol, XLogP of 3.92, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylundecyl hydrogen sulfite is sourced from PubChem (CID 175162504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).