10-methylundecyl hydrogen sulfite

C12H26O3S — CID 175162504

IUPAC10-methylundecyl hydrogen sulfite
SMILESCC(C)CCCCCCCCCOS(=O)O
InChIInChI=1S/C12H26O3S/c1-12(2)10-8-6-4-3-5-7-9-11-15-16(13)14/h12H,3-11H2,1-2H3,(H,13,14)
InChIKeyZUZFEVNKUVBSJH-UHFFFAOYSA-N
MW250.40 g/mol
LogP3.92
Rot. Bonds11

About 10-methylundecyl hydrogen sulfite

10-methylundecyl hydrogen sulfite (PubChem CID 175162504) has the molecular formula C12H26O3S and a molecular weight of 250.40 g/mol. Its IUPAC name is 10-methylundecyl hydrogen sulfite.

Molecular Properties

Compound Name10-methylundecyl hydrogen sulfite
PubChem CID175162504
Molecular FormulaC12H26O3S
Molecular Weight250.40 g/mol
Exact Mass250.16
IUPAC Name10-methylundecyl hydrogen sulfite
SMILESCC(C)CCCCCCCCCOS(=O)O
InChIInChI=1S/C12H26O3S/c1-12(2)10-8-6-4-3-5-7-9-11-15-16(13)14/h12H,3-11H2,1-2H3,(H,13,14)
InChIKeyZUZFEVNKUVBSJH-UHFFFAOYSA-N
XLogP3.92
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds11
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.40
LogP ≤ 53.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 10-methylundecyl hydrogen sulfite with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-methylundecyl hydrogen sulfite?
The IUPAC name of 10-methylundecyl hydrogen sulfite (CID 175162504) is 10-methylundecyl hydrogen sulfite.
What is the SMILES notation for 10-methylundecyl hydrogen sulfite?
The canonical SMILES for 10-methylundecyl hydrogen sulfite is CC(C)CCCCCCCCCOS(=O)O.
What is the InChIKey of 10-methylundecyl hydrogen sulfite?
The InChIKey is ZUZFEVNKUVBSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O3S/c1-12(2)10-8-6-4-3-5-7-9-11-15-16(13)14/h12H,3-11H2,1-2H3,(H,13,14).
What are the key properties of 10-methylundecyl hydrogen sulfite?
10-methylundecyl hydrogen sulfite has a molecular weight of 250.40 g/mol, XLogP of 3.92, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methylundecyl hydrogen sulfite is sourced from PubChem (CID 175162504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).