About 3-methylbutyl hydrogen sulfite
3-methylbutyl hydrogen sulfite (PubChem CID 22742081) has the molecular formula C5H12O3S
and a molecular weight of 152.21 g/mol. Its IUPAC name is 3-methylbutyl hydrogen sulfite.
Molecular Properties
| Compound Name | 3-methylbutyl hydrogen sulfite |
| PubChem CID | 22742081 |
| Molecular Formula | C5H12O3S |
| Molecular Weight | 152.21 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 3-methylbutyl hydrogen sulfite |
| SMILES | CC(C)CCOS(=O)O |
| InChI | InChI=1S/C5H12O3S/c1-5(2)3-4-8-9(6)7/h5H,3-4H2,1-2H3,(H,6,7) |
| InChIKey | YYRQOXOIZXLSAL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl hydrogen sulfite?
The IUPAC name of 3-methylbutyl hydrogen sulfite (CID 22742081) is 3-methylbutyl hydrogen sulfite.
What is the SMILES notation for 3-methylbutyl hydrogen sulfite?
The canonical SMILES for 3-methylbutyl hydrogen sulfite is CC(C)CCOS(=O)O.
What is the InChIKey of 3-methylbutyl hydrogen sulfite?
The InChIKey is YYRQOXOIZXLSAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O3S/c1-5(2)3-4-8-9(6)7/h5H,3-4H2,1-2H3,(H,6,7).
What are the key properties of 3-methylbutyl hydrogen sulfite?
3-methylbutyl hydrogen sulfite has a molecular weight of 152.21 g/mol, XLogP of 1.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl hydrogen sulfite is sourced from PubChem (CID 22742081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).