About 2-hydroxyethyl hydrogen sulfite
2-hydroxyethyl hydrogen sulfite (PubChem CID 6914275) has the molecular formula C2H6O4S
and a molecular weight of 126.13 g/mol. Its IUPAC name is 2-hydroxyethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 2-hydroxyethyl hydrogen sulfite |
| PubChem CID | 6914275 |
| Molecular Formula | C2H6O4S |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.00 |
| IUPAC Name | 2-hydroxyethyl hydrogen sulfite |
| SMILES | O=S(O)OCCO |
| InChI | InChI=1S/C2H6O4S/c3-1-2-6-7(4)5/h3H,1-2H2,(H,4,5) |
| InChIKey | FZKPQHFEMFIDNR-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyethyl hydrogen sulfite?
The IUPAC name of 2-hydroxyethyl hydrogen sulfite (CID 6914275) is 2-hydroxyethyl hydrogen sulfite.
What is the SMILES notation for 2-hydroxyethyl hydrogen sulfite?
The canonical SMILES for 2-hydroxyethyl hydrogen sulfite is O=S(O)OCCO.
What is the InChIKey of 2-hydroxyethyl hydrogen sulfite?
The InChIKey is FZKPQHFEMFIDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6O4S/c3-1-2-6-7(4)5/h3H,1-2H2,(H,4,5).
What are the key properties of 2-hydroxyethyl hydrogen sulfite?
2-hydroxyethyl hydrogen sulfite has a molecular weight of 126.13 g/mol, XLogP of -0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyethyl hydrogen sulfite is sourced from PubChem (CID 6914275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).