About bis(8-methylnonyl) carbonate
bis(8-methylnonyl) carbonate (PubChem CID 23302119) has the molecular formula C21H42O3
and a molecular weight of 342.56 g/mol. Its IUPAC name is bis(8-methylnonyl) carbonate.
Molecular Properties
| Compound Name | bis(8-methylnonyl) carbonate |
| PubChem CID | 23302119 |
| Molecular Formula | C21H42O3 |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.31 |
| IUPAC Name | bis(8-methylnonyl) carbonate |
| SMILES | CC(C)CCCCCCCOC(=O)OCCCCCCCC(C)C |
| InChI | InChI=1S/C21H42O3/c1-19(2)15-11-7-5-9-13-17-23-21(22)24-18-14-10-6-8-12-16-20(3)4/h19-20H,5-18H2,1-4H3 |
| InChIKey | SCNSWPADIGXTIF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(8-methylnonyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-methylnonyl) carbonate?
The IUPAC name of bis(8-methylnonyl) carbonate (CID 23302119) is bis(8-methylnonyl) carbonate.
What is the SMILES notation for bis(8-methylnonyl) carbonate?
The canonical SMILES for bis(8-methylnonyl) carbonate is CC(C)CCCCCCCOC(=O)OCCCCCCCC(C)C.
What is the InChIKey of bis(8-methylnonyl) carbonate?
The InChIKey is SCNSWPADIGXTIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O3/c1-19(2)15-11-7-5-9-13-17-23-21(22)24-18-14-10-6-8-12-16-20(3)4/h19-20H,5-18H2,1-4H3.
What are the key properties of bis(8-methylnonyl) carbonate?
bis(8-methylnonyl) carbonate has a molecular weight of 342.56 g/mol, XLogP of 7.13, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-methylnonyl) carbonate is sourced from PubChem (CID 23302119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).