About [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate
[4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate (PubChem CID 23066899) has the molecular formula C23H42O6
and a molecular weight of 414.58 g/mol. Its IUPAC name is [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate.
Molecular Properties
| Compound Name | [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate |
| PubChem CID | 23066899 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate |
| SMILES | CC(C)CCCCCCOC(=O)OC1CCC(OC(=O)OCCCC(C)C)CC1 |
| InChI | InChI=1S/C23H42O6/c1-18(2)10-7-5-6-8-16-26-22(24)28-20-12-14-21(15-13-20)29-23(25)27-17-9-11-19(3)4/h18-21H,5-17H2,1-4H3 |
| InChIKey | VBRBCYQFNJWIJW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate?
The IUPAC name of [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate (CID 23066899) is [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate.
What is the SMILES notation for [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate?
The canonical SMILES for [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate is CC(C)CCCCCCOC(=O)OC1CCC(OC(=O)OCCCC(C)C)CC1.
What is the InChIKey of [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate?
The InChIKey is VBRBCYQFNJWIJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O6/c1-18(2)10-7-5-6-8-16-26-22(24)28-20-12-14-21(15-13-20)29-23(25)27-17-9-11-19(3)4/h18-21H,5-17H2,1-4H3.
What are the key properties of [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate?
[4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate has a molecular weight of 414.58 g/mol, XLogP of 6.65, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(7-methyloctoxycarbonyloxy)cyclohexyl] 4-methylpentyl carbonate is sourced from PubChem (CID 23066899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).