C45H84O9 — CID 23065857
[2,3-bis(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate (PubChem CID 23065857) has the molecular formula C45H84O9 and a molecular weight of 769.16 g/mol. Its IUPAC name is [2,3-bis(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate.
| Compound Name | [2,3-bis(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate |
|---|---|
| PubChem CID | 23065857 |
| Molecular Formula | C45H84O9 |
| Molecular Weight | 769.16 g/mol |
| Exact Mass | 768.61 |
| IUPAC Name | [2,3-bis(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate |
| SMILES | CC(C)CCCCCCCCCOC(=O)OC1CCCC(OC(=O)OCCCCCCCCCC(C)C)C1OC(=O)OCCCCCCCCCC(C)C |
| InChI | InChI=1S/C45H84O9/c1-37(2)29-22-16-10-7-13-19-25-34-49-43(46)52-40-32-28-33-41(53-44(47)50-35-26-20-14-8-11-17-23-30-38(3)4)42(40)54-45(48)51-36-27-21-15-9-12-18-24-31-39(5)6/h37-42H,7-36H2,1-6H3 |
| InChIKey | CZKFBMPGEUKXOE-UHFFFAOYSA-N |
| XLogP | 14.07 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.16 |
| LogP ≤ 5 | 14.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|