About [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate
[3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate (PubChem CID 23066888) has the molecular formula C25H46O6
and a molecular weight of 442.64 g/mol. Its IUPAC name is [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate.
Molecular Properties
| Compound Name | [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate |
| PubChem CID | 23066888 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate |
| SMILES | CC(C)CCCCCCCCCCOC(=O)OC1CCCC(OC(=O)OCC(C)C)C1 |
| InChI | InChI=1S/C25H46O6/c1-20(2)14-11-9-7-5-6-8-10-12-17-28-24(26)30-22-15-13-16-23(18-22)31-25(27)29-19-21(3)4/h20-23H,5-19H2,1-4H3 |
| InChIKey | KLOPZUZYSUAJIR-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate?
The IUPAC name of [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate (CID 23066888) is [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate.
What is the SMILES notation for [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate?
The canonical SMILES for [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate is CC(C)CCCCCCCCCCOC(=O)OC1CCCC(OC(=O)OCC(C)C)C1.
What is the InChIKey of [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate?
The InChIKey is KLOPZUZYSUAJIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46O6/c1-20(2)14-11-9-7-5-6-8-10-12-17-28-24(26)30-22-15-13-16-23(18-22)31-25(27)29-19-21(3)4/h20-23H,5-19H2,1-4H3.
What are the key properties of [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate?
[3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate has a molecular weight of 442.64 g/mol, XLogP of 7.43, 15 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(11-methyldodecoxycarbonyloxy)cyclohexyl] 2-methylpropyl carbonate is sourced from PubChem (CID 23066888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).