About [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate
[4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate (PubChem CID 23066469) has the molecular formula C32H60O6
and a molecular weight of 540.83 g/mol. Its IUPAC name is [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate.
Molecular Properties
| Compound Name | [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate |
| PubChem CID | 23066469 |
| Molecular Formula | C32H60O6 |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.44 |
| IUPAC Name | [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate |
| SMILES | CC(C)CCCCCCCCCOC(=O)OC1CCC(OC(=O)OCCCCCCCCCC(C)C)CC1 |
| InChI | InChI=1S/C32H60O6/c1-27(2)19-15-11-7-5-9-13-17-25-35-31(33)37-29-21-23-30(24-22-29)38-32(34)36-26-18-14-10-6-8-12-16-20-28(3)4/h27-30H,5-26H2,1-4H3 |
| InChIKey | VYBFMNRWSRLUCK-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate?
The IUPAC name of [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate (CID 23066469) is [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate.
What is the SMILES notation for [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate?
The canonical SMILES for [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate is CC(C)CCCCCCCCCOC(=O)OC1CCC(OC(=O)OCCCCCCCCCC(C)C)CC1.
What is the InChIKey of [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate?
The InChIKey is VYBFMNRWSRLUCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H60O6/c1-27(2)19-15-11-7-5-9-13-17-25-35-31(33)37-29-21-23-30(24-22-29)38-32(34)36-26-18-14-10-6-8-12-16-20-28(3)4/h27-30H,5-26H2,1-4H3.
What are the key properties of [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate?
[4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate has a molecular weight of 540.83 g/mol, XLogP of 10.16, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(10-methylundecoxycarbonyloxy)cyclohexyl] 10-methylundecyl carbonate is sourced from PubChem (CID 23066469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).