About [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate
[3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate (PubChem CID 23066705) has the molecular formula C27H50O6
and a molecular weight of 470.69 g/mol. Its IUPAC name is [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate.
Molecular Properties
| Compound Name | [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate |
| PubChem CID | 23066705 |
| Molecular Formula | C27H50O6 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate |
| SMILES | CC(C)CCCCCCCCOC(=O)OC1CCCC(OC(=O)OCCCCCC(C)C)C1 |
| InChI | InChI=1S/C27H50O6/c1-22(2)15-10-7-5-6-8-12-19-30-26(28)32-24-17-14-18-25(21-24)33-27(29)31-20-13-9-11-16-23(3)4/h22-25H,5-21H2,1-4H3 |
| InChIKey | GYAIBCYOIOFDBY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate?
The IUPAC name of [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate (CID 23066705) is [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate.
What is the SMILES notation for [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate?
The canonical SMILES for [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate is CC(C)CCCCCCCCOC(=O)OC1CCCC(OC(=O)OCCCCCC(C)C)C1.
What is the InChIKey of [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate?
The InChIKey is GYAIBCYOIOFDBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H50O6/c1-22(2)15-10-7-5-6-8-12-19-30-26(28)32-24-17-14-18-25(21-24)33-27(29)31-20-13-9-11-16-23(3)4/h22-25H,5-21H2,1-4H3.
What are the key properties of [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate?
[3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate has a molecular weight of 470.69 g/mol, XLogP of 8.21, 17 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(9-methyldecoxycarbonyloxy)cyclohexyl] 6-methylheptyl carbonate is sourced from PubChem (CID 23066705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).