About 6-methylheptyl 2-hydroxyacetate
6-methylheptyl 2-hydroxyacetate (PubChem CID 139509874) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 6-methylheptyl 2-hydroxyacetate.
Molecular Properties
| Compound Name | 6-methylheptyl 2-hydroxyacetate |
| PubChem CID | 139509874 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 6-methylheptyl 2-hydroxyacetate |
| SMILES | CC(C)CCCCCOC(=O)CO |
| InChI | InChI=1S/C10H20O3/c1-9(2)6-4-3-5-7-13-10(12)8-11/h9,11H,3-8H2,1-2H3 |
| InChIKey | YNTPJHNVRFPXSS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-methylheptyl 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptyl 2-hydroxyacetate?
The IUPAC name of 6-methylheptyl 2-hydroxyacetate (CID 139509874) is 6-methylheptyl 2-hydroxyacetate.
What is the SMILES notation for 6-methylheptyl 2-hydroxyacetate?
The canonical SMILES for 6-methylheptyl 2-hydroxyacetate is CC(C)CCCCCOC(=O)CO.
What is the InChIKey of 6-methylheptyl 2-hydroxyacetate?
The InChIKey is YNTPJHNVRFPXSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-9(2)6-4-3-5-7-13-10(12)8-11/h9,11H,3-8H2,1-2H3.
What are the key properties of 6-methylheptyl 2-hydroxyacetate?
6-methylheptyl 2-hydroxyacetate has a molecular weight of 188.27 g/mol, XLogP of 1.74, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptyl 2-hydroxyacetate is sourced from PubChem (CID 139509874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).