About bis(4-hydroxypentyl) sulfite
bis(4-hydroxypentyl) sulfite (PubChem CID 155124795) has the molecular formula C10H22O5S
and a molecular weight of 254.35 g/mol. Its IUPAC name is bis(4-hydroxypentyl) sulfite.
Molecular Properties
| Compound Name | bis(4-hydroxypentyl) sulfite |
| PubChem CID | 155124795 |
| Molecular Formula | C10H22O5S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | bis(4-hydroxypentyl) sulfite |
| SMILES | CC(O)CCCOS(=O)OCCCC(C)O |
| InChI | InChI=1S/C10H22O5S/c1-9(11)5-3-7-14-16(13)15-8-4-6-10(2)12/h9-12H,3-8H2,1-2H3 |
| InChIKey | ZHIWRUSASYTGES-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(4-hydroxypentyl) sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-hydroxypentyl) sulfite?
The IUPAC name of bis(4-hydroxypentyl) sulfite (CID 155124795) is bis(4-hydroxypentyl) sulfite.
What is the SMILES notation for bis(4-hydroxypentyl) sulfite?
The canonical SMILES for bis(4-hydroxypentyl) sulfite is CC(O)CCCOS(=O)OCCCC(C)O.
What is the InChIKey of bis(4-hydroxypentyl) sulfite?
The InChIKey is ZHIWRUSASYTGES-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O5S/c1-9(11)5-3-7-14-16(13)15-8-4-6-10(2)12/h9-12H,3-8H2,1-2H3.
What are the key properties of bis(4-hydroxypentyl) sulfite?
bis(4-hydroxypentyl) sulfite has a molecular weight of 254.35 g/mol, XLogP of 0.92, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-hydroxypentyl) sulfite is sourced from PubChem (CID 155124795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).