About 1-(4-hydroxypentoxy)pentane-1,4-diol
1-(4-hydroxypentoxy)pentane-1,4-diol (PubChem CID 175142118) has the molecular formula C10H22O4
and a molecular weight of 206.28 g/mol. Its IUPAC name is 1-(4-hydroxypentoxy)pentane-1,4-diol.
Molecular Properties
| Compound Name | 1-(4-hydroxypentoxy)pentane-1,4-diol |
| PubChem CID | 175142118 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-(4-hydroxypentoxy)pentane-1,4-diol |
| SMILES | CC(O)CCCOC(O)CCC(C)O |
| InChI | InChI=1S/C10H22O4/c1-8(11)4-3-7-14-10(13)6-5-9(2)12/h8-13H,3-7H2,1-2H3 |
| InChIKey | DRUFNKBNGHIQTG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-hydroxypentoxy)pentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-hydroxypentoxy)pentane-1,4-diol?
The IUPAC name of 1-(4-hydroxypentoxy)pentane-1,4-diol (CID 175142118) is 1-(4-hydroxypentoxy)pentane-1,4-diol.
What is the SMILES notation for 1-(4-hydroxypentoxy)pentane-1,4-diol?
The canonical SMILES for 1-(4-hydroxypentoxy)pentane-1,4-diol is CC(O)CCCOC(O)CCC(C)O.
What is the InChIKey of 1-(4-hydroxypentoxy)pentane-1,4-diol?
The InChIKey is DRUFNKBNGHIQTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O4/c1-8(11)4-3-7-14-10(13)6-5-9(2)12/h8-13H,3-7H2,1-2H3.
What are the key properties of 1-(4-hydroxypentoxy)pentane-1,4-diol?
1-(4-hydroxypentoxy)pentane-1,4-diol has a molecular weight of 206.28 g/mol, XLogP of 0.64, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-hydroxypentoxy)pentane-1,4-diol is sourced from PubChem (CID 175142118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).