About (4S)-3,4-dimethylhexane;methyliodanuidylmethane
(4S)-3,4-dimethylhexane;methyliodanuidylmethane (PubChem CID 168990410) has the molecular formula C10H24I-
and a molecular weight of 271.21 g/mol. Its IUPAC name is (4S)-3,4-dimethylhexane;methyliodanuidylmethane.
Molecular Properties
| Compound Name | (4S)-3,4-dimethylhexane;methyliodanuidylmethane |
| PubChem CID | 168990410 |
| Molecular Formula | C10H24I- |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (4S)-3,4-dimethylhexane;methyliodanuidylmethane |
| SMILES | CCC(C)[C@@H](C)CC.C[I-]C |
| InChI | InChI=1S/C8H18.C2H6I/c1-5-7(3)8(4)6-2;1-3-2/h7-8H,5-6H2,1-4H3;1-2H3/q;-1/t7-,8?;/m0./s1 |
| InChIKey | XUZMBVRNGSOGJP-JPPWUZRISA-N |
| XLogP | 0.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3,4-dimethylhexane;methyliodanuidylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,4-dimethylhexane;methyliodanuidylmethane?
The IUPAC name of (4S)-3,4-dimethylhexane;methyliodanuidylmethane (CID 168990410) is (4S)-3,4-dimethylhexane;methyliodanuidylmethane.
What is the SMILES notation for (4S)-3,4-dimethylhexane;methyliodanuidylmethane?
The canonical SMILES for (4S)-3,4-dimethylhexane;methyliodanuidylmethane is CCC(C)[C@@H](C)CC.C[I-]C.
What is the InChIKey of (4S)-3,4-dimethylhexane;methyliodanuidylmethane?
The InChIKey is XUZMBVRNGSOGJP-JPPWUZRISA-N. The full InChI is InChI=1S/C8H18.C2H6I/c1-5-7(3)8(4)6-2;1-3-2/h7-8H,5-6H2,1-4H3;1-2H3/q;-1/t7-,8?;/m0./s1.
What are the key properties of (4S)-3,4-dimethylhexane;methyliodanuidylmethane?
(4S)-3,4-dimethylhexane;methyliodanuidylmethane has a molecular weight of 271.21 g/mol, XLogP of 0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,4-dimethylhexane;methyliodanuidylmethane is sourced from PubChem (CID 168990410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).