C7H16O2 — CID 59874869
(2S,3S)-1-hydroperoxy-2,3-dimethylpentane (PubChem CID 59874869) has the molecular formula C7H16O2 and a molecular weight of 132.20 g/mol. Its IUPAC name is (2S,3S)-1-hydroperoxy-2,3-dimethylpentane.
| Compound Name | (2S,3S)-1-hydroperoxy-2,3-dimethylpentane |
|---|---|
| PubChem CID | 59874869 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | (2S,3S)-1-hydroperoxy-2,3-dimethylpentane |
| SMILES | CC[C@H](C)[C@H](C)COO |
| InChI | InChI=1S/C7H16O2/c1-4-6(2)7(3)5-9-8/h6-8H,4-5H2,1-3H3/t6-,7+/m0/s1 |
| InChIKey | ISDBLQMFAUNEPG-NKWVEPMBSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|