About 1,2-dihydroperoxybutane
1,2-dihydroperoxybutane (PubChem CID 174924928) has the molecular formula C4H10O4
and a molecular weight of 122.12 g/mol. Its IUPAC name is 1,2-dihydroperoxybutane.
Molecular Properties
| Compound Name | 1,2-dihydroperoxybutane |
| PubChem CID | 174924928 |
| Molecular Formula | C4H10O4 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 1,2-dihydroperoxybutane |
| SMILES | CCC(COO)OO |
| InChI | InChI=1S/C4H10O4/c1-2-4(8-6)3-7-5/h4-6H,2-3H2,1H3 |
| InChIKey | JEDJRJPAFLXHLG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroperoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroperoxybutane?
The IUPAC name of 1,2-dihydroperoxybutane (CID 174924928) is 1,2-dihydroperoxybutane.
What is the SMILES notation for 1,2-dihydroperoxybutane?
The canonical SMILES for 1,2-dihydroperoxybutane is CCC(COO)OO.
What is the InChIKey of 1,2-dihydroperoxybutane?
The InChIKey is JEDJRJPAFLXHLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O4/c1-2-4(8-6)3-7-5/h4-6H,2-3H2,1H3.
What are the key properties of 1,2-dihydroperoxybutane?
1,2-dihydroperoxybutane has a molecular weight of 122.12 g/mol, XLogP of 0.74, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroperoxybutane is sourced from PubChem (CID 174924928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).