C6H14O — CID 6993006
(2S,3R)-3-methylpentan-2-ol (PubChem CID 6993006) has the molecular formula C6H14O and a molecular weight of 102.18 g/mol. Its IUPAC name is (2S,3R)-3-methylpentan-2-ol.
| Compound Name | (2S,3R)-3-methylpentan-2-ol |
|---|---|
| PubChem CID | 6993006 |
| Molecular Formula | C6H14O |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.10 |
| IUPAC Name | (2S,3R)-3-methylpentan-2-ol |
| SMILES | CC[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3/t5-,6+/m1/s1 |
| InChIKey | ZXNBBWHRUSXUFZ-RITPCOANSA-N |
| XLogP | 1.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |