C16H36O7S2 — CID 174646492
ethane-1,2-diol;3-methyl-1-(3-methylbutoxy)butane;bis(2-sulfanylacetic acid) (PubChem CID 174646492) has the molecular formula C16H36O7S2 and a molecular weight of 404.59 g/mol. Its IUPAC name is ethane-1,2-diol;3-methyl-1-(3-methylbutoxy)butane;bis(2-sulfanylacetic acid).
| Compound Name | ethane-1,2-diol;3-methyl-1-(3-methylbutoxy)butane;bis(2-sulfanylacetic acid) |
|---|---|
| PubChem CID | 174646492 |
| Molecular Formula | C16H36O7S2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | ethane-1,2-diol;3-methyl-1-(3-methylbutoxy)butane;bis(2-sulfanylacetic acid) |
| SMILES | CC(C)CCOCCC(C)C.O=C(O)CS.O=C(O)CS.OCCO |
| InChI | InChI=1S/C10H22O.2C2H4O2S.C2H6O2/c1-9(2)5-7-11-8-6-10(3)4;2*3-2(4)1-5;3-1-2-4/h9-10H,5-8H2,1-4H3;2*5H,1H2,(H,3,4);3-4H,1-2H2 |
| InChIKey | KCSSBGHDZUTWKV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|