About but-2-ene;ethanol;2-ethoxybutane
but-2-ene;ethanol;2-ethoxybutane (PubChem CID 173137452) has the molecular formula C12H28O2
and a molecular weight of 204.35 g/mol. Its IUPAC name is but-2-ene;ethanol;2-ethoxybutane.
Molecular Properties
| Compound Name | but-2-ene;ethanol;2-ethoxybutane |
| PubChem CID | 173137452 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | but-2-ene;ethanol;2-ethoxybutane |
| SMILES | CC=CC.CCO.CCOC(C)CC |
| InChI | InChI=1S/C6H14O.C4H8.C2H6O/c1-4-6(3)7-5-2;1-3-4-2;1-2-3/h6H,4-5H2,1-3H3;3-4H,1-2H3;3H,2H2,1H3 |
| InChIKey | UTSKJQSZMCQVKD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-2-ene;ethanol;2-ethoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-ene;ethanol;2-ethoxybutane?
The IUPAC name of but-2-ene;ethanol;2-ethoxybutane (CID 173137452) is but-2-ene;ethanol;2-ethoxybutane.
What is the SMILES notation for but-2-ene;ethanol;2-ethoxybutane?
The canonical SMILES for but-2-ene;ethanol;2-ethoxybutane is CC=CC.CCO.CCOC(C)CC.
What is the InChIKey of but-2-ene;ethanol;2-ethoxybutane?
The InChIKey is UTSKJQSZMCQVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.C4H8.C2H6O/c1-4-6(3)7-5-2;1-3-4-2;1-2-3/h6H,4-5H2,1-3H3;3-4H,1-2H3;3H,2H2,1H3.
What are the key properties of but-2-ene;ethanol;2-ethoxybutane?
but-2-ene;ethanol;2-ethoxybutane has a molecular weight of 204.35 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-ene;ethanol;2-ethoxybutane is sourced from PubChem (CID 173137452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).