About 2-butan-2-yloxypropyl carbonochloridate
2-butan-2-yloxypropyl carbonochloridate (PubChem CID 21490170) has the molecular formula C8H15ClO3
and a molecular weight of 194.66 g/mol. Its IUPAC name is 2-butan-2-yloxypropyl carbonochloridate.
Molecular Properties
| Compound Name | 2-butan-2-yloxypropyl carbonochloridate |
| PubChem CID | 21490170 |
| Molecular Formula | C8H15ClO3 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-butan-2-yloxypropyl carbonochloridate |
| SMILES | CCC(C)OC(C)COC(=O)Cl |
| InChI | InChI=1S/C8H15ClO3/c1-4-6(2)12-7(3)5-11-8(9)10/h6-7H,4-5H2,1-3H3 |
| InChIKey | ADSUEQSGRSPUGA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-butan-2-yloxypropyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yloxypropyl carbonochloridate?
The IUPAC name of 2-butan-2-yloxypropyl carbonochloridate (CID 21490170) is 2-butan-2-yloxypropyl carbonochloridate.
What is the SMILES notation for 2-butan-2-yloxypropyl carbonochloridate?
The canonical SMILES for 2-butan-2-yloxypropyl carbonochloridate is CCC(C)OC(C)COC(=O)Cl.
What is the InChIKey of 2-butan-2-yloxypropyl carbonochloridate?
The InChIKey is ADSUEQSGRSPUGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO3/c1-4-6(2)12-7(3)5-11-8(9)10/h6-7H,4-5H2,1-3H3.
What are the key properties of 2-butan-2-yloxypropyl carbonochloridate?
2-butan-2-yloxypropyl carbonochloridate has a molecular weight of 194.66 g/mol, XLogP of 2.57, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxypropyl carbonochloridate is sourced from PubChem (CID 21490170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).