C7H16O4S — CID 87134161
2-[2-(2-methoxy-2-sulfanylethoxy)ethoxy]ethanol (PubChem CID 87134161) has the molecular formula C7H16O4S and a molecular weight of 196.27 g/mol. Its IUPAC name is 2-[2-(2-methoxy-2-sulfanylethoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(2-methoxy-2-sulfanylethoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 87134161 |
| Molecular Formula | C7H16O4S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-[2-(2-methoxy-2-sulfanylethoxy)ethoxy]ethanol |
| SMILES | COC(S)COCCOCCO |
| InChI | InChI=1S/C7H16O4S/c1-9-7(12)6-11-5-4-10-3-2-8/h7-8,12H,2-6H2,1H3 |
| InChIKey | FAIRAHURRCKXQZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|