C9H20O7S — CID 175590705
2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;2-sulfanylacetic acid (PubChem CID 175590705) has the molecular formula C9H20O7S and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;2-sulfanylacetic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;2-sulfanylacetic acid |
|---|---|
| PubChem CID | 175590705 |
| Molecular Formula | C9H20O7S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;2-sulfanylacetic acid |
| SMILES | COC(O)COCCOCCO.O=C(O)CS |
| InChI | InChI=1S/C7H16O5.C2H4O2S/c1-10-7(9)6-12-5-4-11-3-2-8;3-2(4)1-5/h7-9H,2-6H2,1H3;5H,1H2,(H,3,4) |
| InChIKey | KQSLTWRHOGRVRV-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|