C10H20O8 — CID 88623730
2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;oxirane-2-carboxylic acid (PubChem CID 88623730) has the molecular formula C10H20O8 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;oxirane-2-carboxylic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 88623730 |
| Molecular Formula | C10H20O8 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;oxirane-2-carboxylic acid |
| SMILES | COC(O)COCCOCCO.O=C(O)C1CO1 |
| InChI | InChI=1S/C7H16O5.C3H4O3/c1-10-7(9)6-12-5-4-11-3-2-8;4-3(5)2-1-6-2/h7-9H,2-6H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | SAXGUYUXONGXRC-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|