C23H38O9 — CID 159534409
2-adamantyl prop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;prop-2-enoic acid (PubChem CID 159534409) has the molecular formula C23H38O9 and a molecular weight of 458.55 g/mol. Its IUPAC name is 2-adamantyl prop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;prop-2-enoic acid.
| Compound Name | 2-adamantyl prop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 159534409 |
| Molecular Formula | C23H38O9 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-adamantyl prop-2-enoate;2-[2-(2-hydroxyethoxy)ethoxy]-1-methoxyethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.C=CC(=O)OC1C2CC3CC(C2)CC1C3.COC(O)COCCOCCO |
| InChI | InChI=1S/C13H18O2.C7H16O5.C3H4O2/c1-2-12(14)15-13-10-4-8-3-9(6-10)7-11(13)5-8;1-10-7(9)6-12-5-4-11-3-2-8;1-2-3(4)5/h2,8-11,13H,1,3-7H2;7-9H,2-6H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | MDKGFFPJDJBSCQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|