C11H23N3O6 — CID 171777142
2-[2-[2-[2-(2-azido-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 171777142) has the molecular formula C11H23N3O6 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-azido-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-(2-azido-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 171777142 |
| Molecular Formula | C11H23N3O6 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-[2-[2-[2-(2-azido-2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | COC(COCCOCCOCCOCCO)N=[N+]=[N-] |
| InChI | InChI=1S/C11H23N3O6/c1-16-11(13-14-12)10-20-9-8-19-7-6-18-5-4-17-3-2-15/h11,15H,2-10H2,1H3 |
| InChIKey | YOCURFISPHDGRO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|