C12H26O2 — CID 142712484
2-(3,7-dimethyloctan-4-yloxy)ethanol (PubChem CID 142712484) has the molecular formula C12H26O2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 2-(3,7-dimethyloctan-4-yloxy)ethanol.
| Compound Name | 2-(3,7-dimethyloctan-4-yloxy)ethanol |
|---|---|
| PubChem CID | 142712484 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 2-(3,7-dimethyloctan-4-yloxy)ethanol |
| SMILES | CCC(C)C(CCC(C)C)OCCO |
| InChI | InChI=1S/C12H26O2/c1-5-11(4)12(14-9-8-13)7-6-10(2)3/h10-13H,5-9H2,1-4H3 |
| InChIKey | ZYLBUWFUBWXOBH-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |