C32H72O5Si3 — CID 153425778
(2S,4R)-2,3,4-tris(3-triethylsilylpropoxy)pentane-1,5-diol (PubChem CID 153425778) has the molecular formula C32H72O5Si3 and a molecular weight of 621.18 g/mol. Its IUPAC name is (2S,4R)-2,3,4-tris(3-triethylsilylpropoxy)pentane-1,5-diol.
| Compound Name | (2S,4R)-2,3,4-tris(3-triethylsilylpropoxy)pentane-1,5-diol |
|---|---|
| PubChem CID | 153425778 |
| Molecular Formula | C32H72O5Si3 |
| Molecular Weight | 621.18 g/mol |
| Exact Mass | 620.47 |
| IUPAC Name | (2S,4R)-2,3,4-tris(3-triethylsilylpropoxy)pentane-1,5-diol |
| SMILES | CC[Si](CC)(CC)CCCOC([C@H](CO)OCCC[Si](CC)(CC)CC)[C@@H](CO)OCCC[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H72O5Si3/c1-10-38(11-2,12-3)25-19-22-35-30(28-33)32(37-24-21-27-40(16-7,17-8)18-9)31(29-34)36-23-20-26-39(13-4,14-5)15-6/h30-34H,10-29H2,1-9H3/t30-,31+,32? |
| InChIKey | CIHHRBYKAIWKOB-BCFRNYDHSA-N |
| XLogP | 8.82 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.18 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|