C35H90O11Si9 — CID 153425789
2,3,4-tris[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol (PubChem CID 153425789) has the molecular formula C35H90O11Si9 and a molecular weight of 939.87 g/mol. Its IUPAC name is 2,3,4-tris[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol.
| Compound Name | 2,3,4-tris[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol |
|---|---|
| PubChem CID | 153425789 |
| Molecular Formula | C35H90O11Si9 |
| Molecular Weight | 939.87 g/mol |
| Exact Mass | 938.44 |
| IUPAC Name | 2,3,4-tris[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOC(CO)C(OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(CO)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C35H90O11Si9/c1-47(2,3)41-53(19,42-48(4,5)6)28-22-25-38-33(31-36)35(40-27-24-30-55(21,45-51(13,14)15)46-52(16,17)18)34(32-37)39-26-23-29-54(20,43-49(7,8)9)44-50(10,11)12/h33-37H,22-32H2,1-21H3 |
| InChIKey | PYOSABVPKRTURE-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 123.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.87 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|