C52H136O17Si15 — CID 153425816
2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3,4,5-tris[3-tris(trimethylsilyloxy)silylpropoxy]hexane-1,6-diol (PubChem CID 153425816) has the molecular formula C52H136O17Si15 and a molecular weight of 1454.93 g/mol. Its IUPAC name is 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3,4,5-tris[3-tris(trimethylsilyloxy)silylpropoxy]hexane-1,6-diol.
| Compound Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3,4,5-tris[3-tris(trimethylsilyloxy)silylpropoxy]hexane-1,6-diol |
|---|---|
| PubChem CID | 153425816 |
| Molecular Formula | C52H136O17Si15 |
| Molecular Weight | 1454.93 g/mol |
| Exact Mass | 1452.63 |
| IUPAC Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3,4,5-tris[3-tris(trimethylsilyloxy)silylpropoxy]hexane-1,6-diol |
| SMILES | C[Si](C)(C)O[Si](C)(CCCOC(CO)C(OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(CO)OCCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C52H136O17Si15/c1-70(2,3)59-81(34,60-71(4,5)6)43-35-39-55-49(47-53)51(57-41-37-45-83(64-75(16,17)18,65-76(19,20)21)66-77(22,23)24)52(58-42-38-46-84(67-78(25,26)27,68-79(28,29)30)69-80(31,32)33)50(48-54)56-40-36-44-82(61-72(7,8)9,62-73(10,11)12)63-74(13,14)15/h49-54H,35-48H2,1-34H3 |
| InChIKey | DTJCXZJQAYHQKK-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1454.93 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|