C42H106O12Si10 — CID 153425775
2,4-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-3,5-bis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol (PubChem CID 153425775) has the molecular formula C42H106O12Si10 and a molecular weight of 1084.16 g/mol. Its IUPAC name is 2,4-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-3,5-bis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol.
| Compound Name | 2,4-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-3,5-bis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol |
|---|---|
| PubChem CID | 153425775 |
| Molecular Formula | C42H106O12Si10 |
| Molecular Weight | 1084.16 g/mol |
| Exact Mass | 1082.54 |
| IUPAC Name | 2,4-bis[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]-3,5-bis[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]hexane-1,6-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOC(CO)C(OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(OCCC[Si](C)(C)O[Si](C)(C)C)C(CO)OCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C42H106O12Si10/c1-55(2,3)49-61(19,20)33-25-29-45-39(37-43)42(48-32-28-36-64(24,53-59(13,14)15)54-60(16,17)18)41(47-31-26-34-62(21,22)50-56(4,5)6)40(38-44)46-30-27-35-63(23,51-57(7,8)9)52-58(10,11)12/h39-44H,25-38H2,1-24H3 |
| InChIKey | GIWYLKNYUIAOHQ-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1084.16 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|