C29H72O8Si6 — CID 153425807
(2S,4R)-2,3,4-tris[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol (PubChem CID 153425807) has the molecular formula C29H72O8Si6 and a molecular weight of 717.40 g/mol. Its IUPAC name is (2S,4R)-2,3,4-tris[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol.
| Compound Name | (2S,4R)-2,3,4-tris[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol |
|---|---|
| PubChem CID | 153425807 |
| Molecular Formula | C29H72O8Si6 |
| Molecular Weight | 717.40 g/mol |
| Exact Mass | 716.38 |
| IUPAC Name | (2S,4R)-2,3,4-tris[3-[dimethyl(trimethylsilyloxy)silyl]propoxy]pentane-1,5-diol |
| SMILES | C[Si](C)(C)O[Si](C)(C)CCCOC([C@H](CO)OCCC[Si](C)(C)O[Si](C)(C)C)[C@@H](CO)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H72O8Si6/c1-38(2,3)35-41(10,11)22-16-19-32-27(25-30)29(34-21-18-24-43(14,15)37-40(7,8)9)28(26-31)33-20-17-23-42(12,13)36-39(4,5)6/h27-31H,16-26H2,1-15H3/t27-,28+,29? |
| InChIKey | ZCZDTYRSIZXEGF-ULJKERAFSA-N |
| XLogP | 7.47 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.40 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|