C30H62O10 — CID 129150171
1,2,3,4-tetraethoxy-5-[4-(2,3,4,5-tetraethoxypentoxy)butoxy]pentane (PubChem CID 129150171) has the molecular formula C30H62O10 and a molecular weight of 582.82 g/mol. Its IUPAC name is 1,2,3,4-tetraethoxy-5-[4-(2,3,4,5-tetraethoxypentoxy)butoxy]pentane.
| Compound Name | 1,2,3,4-tetraethoxy-5-[4-(2,3,4,5-tetraethoxypentoxy)butoxy]pentane |
|---|---|
| PubChem CID | 129150171 |
| Molecular Formula | C30H62O10 |
| Molecular Weight | 582.82 g/mol |
| Exact Mass | 582.43 |
| IUPAC Name | 1,2,3,4-tetraethoxy-5-[4-(2,3,4,5-tetraethoxypentoxy)butoxy]pentane |
| SMILES | CCOCC(OCC)C(OCC)C(COCCCCOCC(OCC)C(OCC)C(COCC)OCC)OCC |
| InChI | InChI=1S/C30H62O10/c1-9-31-21-25(35-11-3)29(39-15-7)27(37-13-5)23-33-19-17-18-20-34-24-28(38-14-6)30(40-16-8)26(36-12-4)22-32-10-2/h25-30H,9-24H2,1-8H3 |
| InChIKey | DCVMGMNMEPKJDB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.82 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|