C25H40N4O5 — CID 170037344
4-[5-butoxy-2,3,4-tris(3-cyanopropoxy)pentoxy]butanenitrile (PubChem CID 170037344) has the molecular formula C25H40N4O5 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[5-butoxy-2,3,4-tris(3-cyanopropoxy)pentoxy]butanenitrile.
| Compound Name | 4-[5-butoxy-2,3,4-tris(3-cyanopropoxy)pentoxy]butanenitrile |
|---|---|
| PubChem CID | 170037344 |
| Molecular Formula | C25H40N4O5 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | 4-[5-butoxy-2,3,4-tris(3-cyanopropoxy)pentoxy]butanenitrile |
| SMILES | CCCCOCC(OCCCC#N)C(OCCCC#N)C(COCCCC#N)OCCCC#N |
| InChI | InChI=1S/C25H40N4O5/c1-2-3-16-30-21-23(32-18-9-5-13-27)25(34-20-11-7-15-29)24(33-19-10-6-14-28)22-31-17-8-4-12-26/h23-25H,2-11,16-22H2,1H3 |
| InChIKey | BEVIPAUTDYVWQU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 141.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|