C18H23N5O5 — CID 170097064
3-[3,4-bis(2-cyanoethoxy)-1,5-bis(cyanomethoxy)pentan-2-yl]oxypropanenitrile (PubChem CID 170097064) has the molecular formula C18H23N5O5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-[3,4-bis(2-cyanoethoxy)-1,5-bis(cyanomethoxy)pentan-2-yl]oxypropanenitrile.
| Compound Name | 3-[3,4-bis(2-cyanoethoxy)-1,5-bis(cyanomethoxy)pentan-2-yl]oxypropanenitrile |
|---|---|
| PubChem CID | 170097064 |
| Molecular Formula | C18H23N5O5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3-[3,4-bis(2-cyanoethoxy)-1,5-bis(cyanomethoxy)pentan-2-yl]oxypropanenitrile |
| SMILES | N#CCCOC(COCC#N)C(OCCC#N)C(COCC#N)OCCC#N |
| InChI | InChI=1S/C18H23N5O5/c19-4-1-9-26-16(14-24-12-7-22)18(28-11-3-6-21)17(15-25-13-8-23)27-10-2-5-20/h16-18H,1-3,9-15H2 |
| InChIKey | ZUJQASVHKWHPOS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 165.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|