About 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile
3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile (PubChem CID 86745402) has the molecular formula C12H19N3O3
and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile.
Molecular Properties
| Compound Name | 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile |
| PubChem CID | 86745402 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile |
| SMILES | CC(OCCC#N)OCCC#N.COCCC#N |
| InChI | InChI=1S/C8H12N2O2.C4H7NO/c1-8(11-6-2-4-9)12-7-3-5-10;1-6-4-2-3-5/h8H,2-3,6-7H2,1H3;2,4H2,1H3 |
| InChIKey | PXDQHNQSIDDOPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 99.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile?
The IUPAC name of 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile (CID 86745402) is 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile.
What is the SMILES notation for 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile?
The canonical SMILES for 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile is CC(OCCC#N)OCCC#N.COCCC#N.
What is the InChIKey of 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile?
The InChIKey is PXDQHNQSIDDOPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2.C4H7NO/c1-8(11-6-2-4-9)12-7-3-5-10;1-6-4-2-3-5/h8H,2-3,6-7H2,1H3;2,4H2,1H3.
What are the key properties of 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile?
3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile has a molecular weight of 253.30 g/mol, XLogP of 1.74, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(2-cyanoethoxy)ethoxy]propanenitrile;3-methoxypropanenitrile is sourced from PubChem (CID 86745402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).