C9H20N2O3P+ — CID 57227834
2-cyanoethoxy-[di(propan-2-yl)amino]-dihydroxyphosphanium (PubChem CID 57227834) has the molecular formula C9H20N2O3P+ and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-cyanoethoxy-[di(propan-2-yl)amino]-dihydroxyphosphanium.
| Compound Name | 2-cyanoethoxy-[di(propan-2-yl)amino]-dihydroxyphosphanium |
|---|---|
| PubChem CID | 57227834 |
| Molecular Formula | C9H20N2O3P+ |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-cyanoethoxy-[di(propan-2-yl)amino]-dihydroxyphosphanium |
| SMILES | CC(C)N(C(C)C)[P+](O)(O)OCCC#N |
| InChI | InChI=1S/C9H20N2O3P/c1-8(2)11(9(3)4)15(12,13)14-7-5-6-10/h8-9,12-13H,5,7H2,1-4H3/q+1 |
| InChIKey | OMVXTPWFTQUCEL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|