C15H33N2O2P — CID 87379466
3-[[di(propan-2-yl)amino]-hydroxy-di(propan-2-yl)-λ5-phosphanyl]oxypropanenitrile (PubChem CID 87379466) has the molecular formula C15H33N2O2P and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-[[di(propan-2-yl)amino]-hydroxy-di(propan-2-yl)-λ5-phosphanyl]oxypropanenitrile.
| Compound Name | 3-[[di(propan-2-yl)amino]-hydroxy-di(propan-2-yl)-λ5-phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 87379466 |
| Molecular Formula | C15H33N2O2P |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 3-[[di(propan-2-yl)amino]-hydroxy-di(propan-2-yl)-λ5-phosphanyl]oxypropanenitrile |
| SMILES | CC(C)N(C(C)C)P(O)(OCCC#N)(C(C)C)C(C)C |
| InChI | InChI=1S/C15H33N2O2P/c1-12(2)17(13(3)4)20(18,14(5)6,15(7)8)19-11-9-10-16/h12-15,18H,9,11H2,1-8H3 |
| InChIKey | LSLRNQBUTPFGCL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|