C13H29N2O2P — CID 87184817
3-[tert-butyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile (PubChem CID 87184817) has the molecular formula C13H29N2O2P and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-[tert-butyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile.
| Compound Name | 3-[tert-butyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
|---|---|
| PubChem CID | 87184817 |
| Molecular Formula | C13H29N2O2P |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 3-[tert-butyl-[di(propan-2-yl)amino]-dihydroxy-λ5-phosphanyl]propanenitrile |
| SMILES | CC(C)N(C(C)C)P(O)(O)(CCC#N)C(C)(C)C |
| InChI | InChI=1S/C13H29N2O2P/c1-11(2)15(12(3)4)18(16,17,10-8-9-14)13(5,6)7/h11-12,16-17H,8,10H2,1-7H3 |
| InChIKey | INQALXTZLVEXSQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|