C40H72N6O4S2 — CID 160746486
2-N,2-N,3-N,3-N-tetrakis(8-cyanooctyl)butane-2,3-disulfonamide (PubChem CID 160746486) has the molecular formula C40H72N6O4S2 and a molecular weight of 765.19 g/mol. Its IUPAC name is 2-N,2-N,3-N,3-N-tetrakis(8-cyanooctyl)butane-2,3-disulfonamide.
| Compound Name | 2-N,2-N,3-N,3-N-tetrakis(8-cyanooctyl)butane-2,3-disulfonamide |
|---|---|
| PubChem CID | 160746486 |
| Molecular Formula | C40H72N6O4S2 |
| Molecular Weight | 765.19 g/mol |
| Exact Mass | 764.51 |
| IUPAC Name | 2-N,2-N,3-N,3-N-tetrakis(8-cyanooctyl)butane-2,3-disulfonamide |
| SMILES | CC(C(C)S(=O)(=O)N(CCCCCCCCC#N)CCCCCCCCC#N)S(=O)(=O)N(CCCCCCCCC#N)CCCCCCCCC#N |
| InChI | InChI=1S/C40H72N6O4S2/c1-39(51(47,48)45(35-27-19-11-3-7-15-23-31-41)36-28-20-12-4-8-16-24-32-42)40(2)52(49,50)46(37-29-21-13-5-9-17-25-33-43)38-30-22-14-6-10-18-26-34-44/h39-40H,3-30,35-38H2,1-2H3 |
| InChIKey | RWGFTACSEHQGRH-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 169.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.19 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|