C23H43N3O2S — CID 172815352
N,N-bis(7-cyanoheptyl)heptane-1-sulfonamide (PubChem CID 172815352) has the molecular formula C23H43N3O2S and a molecular weight of 425.68 g/mol. Its IUPAC name is N,N-bis(7-cyanoheptyl)heptane-1-sulfonamide.
| Compound Name | N,N-bis(7-cyanoheptyl)heptane-1-sulfonamide |
|---|---|
| PubChem CID | 172815352 |
| Molecular Formula | C23H43N3O2S |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.31 |
| IUPAC Name | N,N-bis(7-cyanoheptyl)heptane-1-sulfonamide |
| SMILES | CCCCCCCS(=O)(=O)N(CCCCCCCC#N)CCCCCCCC#N |
| InChI | InChI=1S/C23H43N3O2S/c1-2-3-4-13-18-23-29(27,28)26(21-16-11-7-5-9-14-19-24)22-17-12-8-6-10-15-20-25/h2-18,21-23H2,1H3 |
| InChIKey | SSTTUDLLMYBRQZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|