C29H55N3O2S — CID 161312679
N,N-bis(9-cyanononyl)nonane-1-sulfonamide (PubChem CID 161312679) has the molecular formula C29H55N3O2S and a molecular weight of 509.85 g/mol. Its IUPAC name is N,N-bis(9-cyanononyl)nonane-1-sulfonamide.
| Compound Name | N,N-bis(9-cyanononyl)nonane-1-sulfonamide |
|---|---|
| PubChem CID | 161312679 |
| Molecular Formula | C29H55N3O2S |
| Molecular Weight | 509.85 g/mol |
| Exact Mass | 509.40 |
| IUPAC Name | N,N-bis(9-cyanononyl)nonane-1-sulfonamide |
| SMILES | CCCCCCCCCS(=O)(=O)N(CCCCCCCCCC#N)CCCCCCCCCC#N |
| InChI | InChI=1S/C29H55N3O2S/c1-2-3-4-5-14-19-24-29-35(33,34)32(27-22-17-12-8-6-10-15-20-25-30)28-23-18-13-9-7-11-16-21-26-31/h2-24,27-29H2,1H3 |
| InChIKey | VJCDIRCUPMGMCL-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.85 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|