C25H54N2O4S2 — CID 140586824
N,N,N',N'-tetrahexylmethanedisulfonamide (PubChem CID 140586824) has the molecular formula C25H54N2O4S2 and a molecular weight of 510.85 g/mol. Its IUPAC name is N,N,N',N'-tetrahexylmethanedisulfonamide.
| Compound Name | N,N,N',N'-tetrahexylmethanedisulfonamide |
|---|---|
| PubChem CID | 140586824 |
| Molecular Formula | C25H54N2O4S2 |
| Molecular Weight | 510.85 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | N,N,N',N'-tetrahexylmethanedisulfonamide |
| SMILES | CCCCCCN(CCCCCC)S(=O)(=O)CS(=O)(=O)N(CCCCCC)CCCCCC |
| InChI | InChI=1S/C25H54N2O4S2/c1-5-9-13-17-21-26(22-18-14-10-6-2)32(28,29)25-33(30,31)27(23-19-15-11-7-3)24-20-16-12-8-4/h5-25H2,1-4H3 |
| InChIKey | QRSUKVCQFFGPAL-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.85 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|