C19H35N3O2S — CID 161351187
N,N-bis(6-cyanohexyl)pentane-1-sulfonamide (PubChem CID 161351187) has the molecular formula C19H35N3O2S and a molecular weight of 369.58 g/mol. Its IUPAC name is N,N-bis(6-cyanohexyl)pentane-1-sulfonamide.
| Compound Name | N,N-bis(6-cyanohexyl)pentane-1-sulfonamide |
|---|---|
| PubChem CID | 161351187 |
| Molecular Formula | C19H35N3O2S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | N,N-bis(6-cyanohexyl)pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)N(CCCCCCC#N)CCCCCCC#N |
| InChI | InChI=1S/C19H35N3O2S/c1-2-3-14-19-25(23,24)22(17-12-8-4-6-10-15-20)18-13-9-5-7-11-16-21/h2-14,17-19H2,1H3 |
| InChIKey | VNYGLWIIQNAMKQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|