C46H84N6O4S2 — CID 172854065
1-N,1-N,1-N',1-N'-tetrakis(9-cyanononyl)hexane-1,1-disulfonamide (PubChem CID 172854065) has the molecular formula C46H84N6O4S2 and a molecular weight of 849.35 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N'-tetrakis(9-cyanononyl)hexane-1,1-disulfonamide.
| Compound Name | 1-N,1-N,1-N',1-N'-tetrakis(9-cyanononyl)hexane-1,1-disulfonamide |
|---|---|
| PubChem CID | 172854065 |
| Molecular Formula | C46H84N6O4S2 |
| Molecular Weight | 849.35 g/mol |
| Exact Mass | 848.60 |
| IUPAC Name | 1-N,1-N,1-N',1-N'-tetrakis(9-cyanononyl)hexane-1,1-disulfonamide |
| SMILES | CCCCCC(S(=O)(=O)N(CCCCCCCCCC#N)CCCCCCCCCC#N)S(=O)(=O)N(CCCCCCCCCC#N)CCCCCCCCCC#N |
| InChI | InChI=1S/C46H84N6O4S2/c1-2-3-28-37-46(57(53,54)51(42-33-24-16-8-4-12-20-29-38-47)43-34-25-17-9-5-13-21-30-39-48)58(55,56)52(44-35-26-18-10-6-14-22-31-40-49)45-36-27-19-11-7-15-23-32-41-50/h46H,2-37,42-45H2,1H3 |
| InChIKey | YLOSREWMKBHSKA-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 169.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.35 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|