C24H48N2O2S — CID 151178952
1-cyano-N,N-dioctylheptane-1-sulfonamide (PubChem CID 151178952) has the molecular formula C24H48N2O2S and a molecular weight of 428.73 g/mol. Its IUPAC name is 1-cyano-N,N-dioctylheptane-1-sulfonamide.
| Compound Name | 1-cyano-N,N-dioctylheptane-1-sulfonamide |
|---|---|
| PubChem CID | 151178952 |
| Molecular Formula | C24H48N2O2S |
| Molecular Weight | 428.73 g/mol |
| Exact Mass | 428.34 |
| IUPAC Name | 1-cyano-N,N-dioctylheptane-1-sulfonamide |
| SMILES | CCCCCCCCN(CCCCCCCC)S(=O)(=O)C(C#N)CCCCCC |
| InChI | InChI=1S/C24H48N2O2S/c1-4-7-10-13-15-18-21-26(22-19-16-14-11-8-5-2)29(27,28)24(23-25)20-17-12-9-6-3/h24H,4-22H2,1-3H3 |
| InChIKey | NDWNBKUGYHKHBP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|